Difference between revisions of "CPD-13855"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite CPD-13855 == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13855 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n7-methylguanosine 5'-diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sbasprrecyvbrf-kqynxxcusa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 455.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12817]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12817]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n7-methylguanosine 5'-diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=455.214}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13855
- common-name:
- n7-methylguanosine 5'-diphosphate
- smiles:
- c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
- inchi-key:
- sbasprrecyvbrf-kqynxxcusa-l
- molecular-weight:
- 455.214
