Difference between revisions of "PHOSPHORYL-CHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-BETA-ASPARTYL-P == * common-name: ** l-aspartyl-4-phosphate * smiles: ** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-] * inchi-key: ** ixznk...")
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * smiles: ** c[n+](ccop([o-])([o-])=o)(c)c * inchi-key: ** yhhsonzfoiemcp-uhfffaoy...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-BETA-ASPARTYL-P ==
+
== Metabolite PHOSPHORYL-CHOLINE ==
 
* common-name:
 
* common-name:
** l-aspartyl-4-phosphate
+
** phosphocholine
 
* smiles:
 
* smiles:
** c(c([n+])c(=o)[o-])c(=o)op([o-])(=o)[o-]
+
** c[n+](ccop([o-])([o-])=o)(c)c
 
* inchi-key:
 
* inchi-key:
** ixznktpiykdigg-reohclbhsa-l
+
** yhhsonzfoiemcp-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 211.068
+
** 182.136
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[2.7.7.15-RXN]]
* [[ASPARTATEKIN-RXN]]
+
* [[CHLPCTDh]]
 +
* [[RXN-5647]]
 +
* [[RXN-9614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[CHOLINE-KINASE-RXN]]
* [[ASPARTATEKIN-RXN]]
+
* [[PHOSPHOLIPASE-C-RXN]]
 +
* [[RXN-15212]]
 +
* [[RXN-9614]]
 +
* [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-aspartyl-4-phosphate}}
+
{{#set: common-name=phosphocholine}}
{{#set: inchi-key=inchikey=ixznktpiykdigg-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}}
{{#set: molecular-weight=211.068}}
+
{{#set: molecular-weight=182.136}}

Latest revision as of 11:17, 18 March 2021

Metabolite PHOSPHORYL-CHOLINE

  • common-name:
    • phosphocholine
  • smiles:
    • c[n+](ccop([o-])([o-])=o)(c)c
  • inchi-key:
    • yhhsonzfoiemcp-uhfffaoysa-m
  • molecular-weight:
    • 182.136

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality