Difference between revisions of "CPD-16825"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-6-P == * common-name: ** n-acetyl-d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * PH...") |
(Created page with "Category:metabolite == Metabolite CPD-16825 == * common-name: ** (s)-equol 4'-sulfate * smiles: ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) * inchi-key: **...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-16825 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-equol 4'-sulfate |
| + | * smiles: | ||
| + | ** c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o) | ||
| + | * inchi-key: | ||
| + | ** uxojwgsgkuymia-gfccvegcsa-m | ||
| + | * molecular-weight: | ||
| + | ** 321.324 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-15589]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15589]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-equol 4'-sulfate}} |
| + | {{#set: inchi-key=inchikey=uxojwgsgkuymia-gfccvegcsa-m}} | ||
| + | {{#set: molecular-weight=321.324}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-16825
- common-name:
- (s)-equol 4'-sulfate
- smiles:
- c1(c=c(c=c2(occ(cc=12)c3(c=cc(=cc=3)os([o-])(=o)=o)))o)
- inchi-key:
- uxojwgsgkuymia-gfccvegcsa-m
- molecular-weight:
- 321.324
