Difference between revisions of "DIPEPTIDES"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite DIPEPTIDES == * common-name: ** a dipeptide == Reaction(s) known to consume the compound == * 3.4.13.18-RXN == Reaction(s) known to p...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIPEPTIDES == |
* common-name: | * common-name: | ||
− | ** | + | ** a dipeptide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.4.13.18-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3.4.11.4-RXN]] |
+ | * [[3.4.14.5-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a dipeptide}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite DIPEPTIDES
- common-name:
- a dipeptide