Difference between revisions of "DIHYDRO-DIOH-BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Acetoacetyl-ACPs == * common-name: ** an acetoacetyl-[acp] == Reaction(s) known to consume the compound == * RXN-9514 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite DIHYDRO-DIOH-BENZOATE == * common-name: ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate * smiles: ** c([o-])(=o)c1(=cc=cc(c1o)o) * inchi-key...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDRO-DIOH-BENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate |
| + | * smiles: | ||
| + | ** c([o-])(=o)c1(=cc=cc(c1o)o) | ||
| + | * inchi-key: | ||
| + | ** incswykiciyahb-wdskdsinsa-m | ||
| + | * molecular-weight: | ||
| + | ** 155.13 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DHBDEHYD-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate}} |
| + | {{#set: inchi-key=inchikey=incswykiciyahb-wdskdsinsa-m}} | ||
| + | {{#set: molecular-weight=155.13}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite DIHYDRO-DIOH-BENZOATE
- common-name:
- (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate
- smiles:
- c([o-])(=o)c1(=cc=cc(c1o)o)
- inchi-key:
- incswykiciyahb-wdskdsinsa-m
- molecular-weight:
- 155.13
