Difference between revisions of "TRP"

Latest revision as of 11:17, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite STEAROYL-COA ==
+== Metabolite TRP ==
 * common-name:
-** stearoyl-coa
+** l-tryptophan
 * smiles:
-** cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
 * inchi-key:
-** siarjekbadxqjg-lfzquhgesa-j
+** qivbcdijiajpqs-vifpvbqesa-n
 * molecular-weight:
-** 1029.968
+** 204.228
 == Reaction(s) known to consume the compound ==
-* [[1.14.19.1-RXN]]
+* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
-* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+* [[RXN-8665]]
-* [[RXN-13294]]
+* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
-* [[RXN-9624]]
+* [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]]
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]]
+* [[RXN0-2382]]
-* [[RXN-16380]]
+* [[TRYPSYN-RXN]]
-* [[RXN3O-5304]]
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=stearoyl-coa}}
+{{#set: common-name=l-tryptophan}}
-{{#set: inchi-key=inchikey=siarjekbadxqjg-lfzquhgesa-j}}
+{{#set: inchi-key=inchikey=qivbcdijiajpqs-vifpvbqesa-n}}
-{{#set: molecular-weight=1029.968}}
+{{#set: molecular-weight=204.228}}