Difference between revisions of "CPD-14422"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIS-DELTA3-ENOYL-COA == * common-name: ** a (3z)-alkan-3-enoyl-coa == Reaction(s) known to consume the compound == * ENOYL-COA-DELTA-IS...") |
(Created page with "Category:metabolite == Metabolite CPD-14422 == * common-name: ** 3-oxo-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14422 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-oxo-icosatrienoyl-coa |
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** dfyfqqxxtclfng-ubqhhbpxsa-j | ||
+ | * molecular-weight: | ||
+ | ** 1065.958 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12994]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13441]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-oxo-icosatrienoyl-coa}} |
+ | {{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}} | ||
+ | {{#set: molecular-weight=1065.958}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-14422
- common-name:
- 3-oxo-icosatrienoyl-coa
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- dfyfqqxxtclfng-ubqhhbpxsa-j
- molecular-weight:
- 1065.958