Difference between revisions of "CPD-14706"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21133 == * transcription-direction: ** positive * right-end-position: ** 50140 * left-end-position: ** 36655 * centisome-position: ** 18.515059...") |
(Created page with "Category:metabolite == Metabolite CPD-14706 == * common-name: ** 4-hydroxy-2-nonenal-[l-cys] conjugate * smiles: ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] * inchi-key: ** salp...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14706 == |
− | * | + | * common-name: |
− | ** | + | ** 4-hydroxy-2-nonenal-[l-cys] conjugate |
− | + | * smiles: | |
− | + | ** cccccc(o)c(cc=o)scc([n+])c(=o)[o-] | |
− | + | * inchi-key: | |
− | + | ** salpdushmtyyoh-uhfffaoysa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 277.378 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13677]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=4-hydroxy-2-nonenal-[l-cys] conjugate}} | |
− | + | {{#set: inchi-key=inchikey=salpdushmtyyoh-uhfffaoysa-n}} | |
− | + | {{#set: molecular-weight=277.378}} | |
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | == | ||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-14706
- common-name:
- 4-hydroxy-2-nonenal-[l-cys] conjugate
- smiles:
- cccccc(o)c(cc=o)scc([n+])c(=o)[o-]
- inchi-key:
- salpdushmtyyoh-uhfffaoysa-n
- molecular-weight:
- 277.378
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "4-hydroxy-2-nonenal-[l-cys] conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.