Difference between revisions of "PARAOXON"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Double-helix-DNA == * common-name: ** a double-helix dna == Reaction(s) known to consume the compound == * RXN-11135 == Reaction(s) k...")
(Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key: ** wymsbxtxohuigt-uhfffaoysa-n...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Double-helix-DNA ==
+
== Metabolite PARAOXON ==
 
* common-name:
 
* common-name:
** a double-helix dna
+
** paraoxon
 +
* smiles:
 +
** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
 +
* inchi-key:
 +
** wymsbxtxohuigt-uhfffaoysa-n
 +
* molecular-weight:
 +
** 275.197
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11135]]
+
* [[RXN-8746]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a double-helix dna}}
+
{{#set: common-name=paraoxon}}
 +
{{#set: inchi-key=inchikey=wymsbxtxohuigt-uhfffaoysa-n}}
 +
{{#set: molecular-weight=275.197}}

Latest revision as of 11:17, 18 March 2021

Metabolite PARAOXON

  • common-name:
    • paraoxon
  • smiles:
    • ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o
  • inchi-key:
    • wymsbxtxohuigt-uhfffaoysa-n
  • molecular-weight:
    • 275.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality