Difference between revisions of "LIOTHYRONINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13512 == * transcription-direction: ** negative * right-end-position: ** 151107 * left-end-position: ** 145666 * centisome-position: ** 43.504856...") |
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) * in...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite LIOTHYRONINE == |
− | * | + | * common-name: |
− | ** | + | ** 3,5,3'-triiodo-l-thyronine |
− | + | * smiles: | |
− | + | ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) | |
− | + | * inchi-key: | |
− | * | + | ** auyycjsjgjycds-lbprgkrzsa-n |
− | + | * molecular-weight: | |
− | ** | + | ** 650.978 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10607]] | |
− | = | + | * [[RXN-10609]] |
− | + | * [[RXN-10615]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine}} | |
− | + | {{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}} | |
− | ** | + | {{#set: molecular-weight=650.978}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite LIOTHYRONINE
- common-name:
- 3,5,3'-triiodo-l-thyronine
- smiles:
- c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
- inchi-key:
- auyycjsjgjycds-lbprgkrzsa-n
- molecular-weight:
- 650.978