Difference between revisions of "L-THREONINE-O-3-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16080 == * transcription-direction: ** negative * right-end-position: ** 118020 * left-end-position: ** 83102 * centisome-position: ** 28.846148...") |
(Created page with "Category:metabolite == Metabolite L-THREONINE-O-3-PHOSPHATE == * common-name: ** l-threonine 3-o-phosphate * smiles: ** cc(op([o-])([o-])=o)c([n+])c([o-])=o * inchi-key: *...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite L-THREONINE-O-3-PHOSPHATE == |
− | * | + | * common-name: |
− | ** | + | ** l-threonine 3-o-phosphate |
− | * | + | * smiles: |
− | ** | + | ** cc(op([o-])([o-])=o)c([n+])c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** usrgiujoyoxoqj-gbxijsldsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 197.084 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[4.1.1.81-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=l-threonine 3-o-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=usrgiujoyoxoqj-gbxijsldsa-l}} | |
− | + | {{#set: molecular-weight=197.084}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-THREONINE-O-3-PHOSPHATE
- common-name:
- l-threonine 3-o-phosphate
- smiles:
- cc(op([o-])([o-])=o)c([n+])c([o-])=o
- inchi-key:
- usrgiujoyoxoqj-gbxijsldsa-l
- molecular-weight:
- 197.084