Difference between revisions of "L-THREONINE-O-3-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16080 == * transcription-direction: ** negative * right-end-position: ** 118020 * left-end-position: ** 83102 * centisome-position: ** 28.846148...")
 
(Created page with "Category:metabolite == Metabolite L-THREONINE-O-3-PHOSPHATE == * common-name: ** l-threonine 3-o-phosphate * smiles: ** cc(op([o-])([o-])=o)c([n+])c([o-])=o * inchi-key: *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16080 ==
+
== Metabolite L-THREONINE-O-3-PHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-threonine 3-o-phosphate
−
* right-end-position:
+
* smiles:
−
** 118020
+
** cc(op([o-])([o-])=o)c([n+])c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 83102
+
** usrgiujoyoxoqj-gbxijsldsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 28.846148   
+
** 197.084
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[4.1.1.81-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[DNA-LIGASE-ATP-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=l-threonine 3-o-phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=usrgiujoyoxoqj-gbxijsldsa-l}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=197.084}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17917]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17918]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17919]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=118020}}
 
−
{{#set: left-end-position=83102}}
 
−
{{#set: centisome-position=28.846148    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite L-THREONINE-O-3-PHOSPHATE

  • common-name:
    • l-threonine 3-o-phosphate
  • smiles:
    • cc(op([o-])([o-])=o)c([n+])c([o-])=o
  • inchi-key:
    • usrgiujoyoxoqj-gbxijsldsa-l
  • molecular-weight:
    • 197.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-THREONINE-O-3-PHOSPHATE&oldid=137717"