Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08749 == * transcription-direction: ** negative * right-end-position: ** 31685 * left-end-position: ** 9850 * centisome-position: ** 19.793425...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == * common-name: ** 5-hydroxyindole acetaldehyde * smiles: ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) * inchi-key:...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE == |
− | * | + | * common-name: |
− | ** | + | ** 5-hydroxyindole acetaldehyde |
− | + | * smiles: | |
− | + | ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) | |
− | + | * inchi-key: | |
− | + | ** obfapciusyhfie-uhfffaoysa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 175.187 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10780]] | |
− | + | * [[RXN-10781]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-10778]] | |
− | ** | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-hydroxyindole acetaldehyde}} | |
− | + | {{#set: inchi-key=inchikey=obfapciusyhfie-uhfffaoysa-n}} | |
− | + | {{#set: molecular-weight=175.187}} | |
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | == | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE
- common-name:
- 5-hydroxyindole acetaldehyde
- smiles:
- c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o))
- inchi-key:
- obfapciusyhfie-uhfffaoysa-n
- molecular-weight:
- 175.187