Difference between revisions of "CPD-15838"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20979 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-12086 ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-15838 == * common-name: ** γ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c * inchi-key: *...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15838 == |
| − | + | * common-name: | |
| − | + | ** γ-tocotrienol | |
| − | + | * smiles: | |
| − | * | + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c |
| − | + | * inchi-key: | |
| − | ** | + | ** otxntmvvoobzcv-wazjvijmsa-n |
| − | + | * molecular-weight: | |
| − | * | + | ** 410.639 |
| − | *** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-14918]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=γ-tocotrienol}} |
| − | * [[ | + | {{#set: inchi-key=inchikey=otxntmvvoobzcv-wazjvijmsa-n}} |
| − | + | {{#set: molecular-weight=410.639}} | |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15838
- common-name:
- γ-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=c(c)c=2c)o)))c)c)c
- inchi-key:
- otxntmvvoobzcv-wazjvijmsa-n
- molecular-weight:
- 410.639
