Difference between revisions of "GALACTOSE-1P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19950 == * transcription-direction: ** negative * right-end-position: ** 75307 * left-end-position: ** 58121 * centisome-position: ** 26.746279...") |
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite GALACTOSE-1P == |
| − | * | + | * common-name: |
| − | ** | + | ** α-d-galactose 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hxxfsfrbohsimq-fprjbgldsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 258.121 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[GALACTOKIN-RXN]] |
| − | == Reaction(s) | + | * [[GALACTURIDYLYLTRANS-RXN]] |
| − | * [[ | + | * [[UTPHEXPURIDYLYLTRANS-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[GALACTOKIN-RXN]] |
| − | + | * [[GALACTURIDYLYLTRANS-RXN]] | |
| − | {{#set: | + | * [[UTPHEXPURIDYLYLTRANS-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=α-d-galactose 1-phosphate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}} |
| − | + | {{#set: molecular-weight=258.121}} | |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite GALACTOSE-1P
- common-name:
- α-d-galactose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-fprjbgldsa-l
- molecular-weight:
- 258.121
