Difference between revisions of "3-P-HYDROXYPYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21433 == * transcription-direction: ** positive * right-end-position: ** 97407 * left-end-position: ** 83215 * centisome-position: ** 13.886896...") |
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * smiles: ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] * inchi-key: ** lflucdosqpjj...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 3-P-HYDROXYPYRUVATE == |
− | * | + | * common-name: |
− | ** | + | ** 3-phosphooxypyruvate |
− | + | * smiles: | |
− | + | ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** lflucdosqpjjbe-uhfffaoysa-k |
− | + | * molecular-weight: | |
− | + | ** 181.018 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[PGLYCDEHYDROG-RXN]] | |
− | == | + | * [[PSERTRANSAM-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[PGLYCDEHYDROG-RXN]] |
− | ** | + | * [[PSERTRANSAM-RXN]] |
− | + | * [[RXN-17808]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | ** | + | {{#set: common-name=3-phosphooxypyruvate}} |
− | * [[ | + | {{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}} |
− | + | {{#set: molecular-weight=181.018}} | |
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite 3-P-HYDROXYPYRUVATE
- common-name:
- 3-phosphooxypyruvate
- smiles:
- c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
- inchi-key:
- lflucdosqpjjbe-uhfffaoysa-k
- molecular-weight:
- 181.018