Difference between revisions of "CPD-11671"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10376 == * transcription-direction: ** negative * right-end-position: ** 705569 * left-end-position: ** 695743 * centisome-position: ** 85.99697...") |
(Created page with "Category:metabolite == Metabolite CPD-11671 == * common-name: ** 5-hydroxytryptophol * smiles: ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) * inchi-key: ** kqrohcsyogbqgj-uhfffaoysa-n...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11671 == |
| − | * | + | * common-name: |
| − | ** | + | ** 5-hydroxytryptophol |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)cc1(=cnc2(=c1c=c(o)c=c2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** kqrohcsyogbqgj-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 177.202 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10782]] |
| − | == Reaction(s) | + | * [[RXN-10784]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10781]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=5-hydroxytryptophol}} | |
| − | + | {{#set: inchi-key=inchikey=kqrohcsyogbqgj-uhfffaoysa-n}} | |
| − | + | {{#set: molecular-weight=177.202}} | |
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-11671
- common-name:
- 5-hydroxytryptophol
- smiles:
- c(o)cc1(=cnc2(=c1c=c(o)c=c2))
- inchi-key:
- kqrohcsyogbqgj-uhfffaoysa-n
- molecular-weight:
- 177.202
