Difference between revisions of "CPD-15368"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17527 == * transcription-direction: ** positive * right-end-position: ** 260493 * left-end-position: ** 248162 * centisome-position: ** 95.22022...")
 
(Created page with "Category:metabolite == Metabolite CPD-15368 == * common-name: ** 3-oxo-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17527 ==
+
== Metabolite CPD-15368 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxo-lesqueroloyl-coa
* right-end-position:
+
* smiles:
** 260493
+
** ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 248162
+
** nqxrrzbozbkgiu-mhaufedzsa-j
* centisome-position:
+
* molecular-weight:
** 95.22022   
+
** 1085.989
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14493]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.4.19.12-RXN]]
+
* [[RXN-14492]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-lesqueroloyl-coa}}
{{#set: transcription-direction=positive}}
+
{{#set: inchi-key=inchikey=nqxrrzbozbkgiu-mhaufedzsa-j}}
{{#set: right-end-position=260493}}
+
{{#set: molecular-weight=1085.989}}
{{#set: left-end-position=248162}}
 
{{#set: centisome-position=95.22022    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-15368

  • common-name:
    • 3-oxo-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nqxrrzbozbkgiu-mhaufedzsa-j
  • molecular-weight:
    • 1085.989

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality