Difference between revisions of "ISOVALERYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17329 == * transcription-direction: ** positive * right-end-position: ** 130562 * left-end-position: ** 116944 * centisome-position: ** 44.28087...") |
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * smiles: ** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ISOVALERYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** isovaleryl-coa |
− | + | * smiles: | |
− | * | + | ** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c |
− | + | * inchi-key: | |
− | ** | + | ** uyvziwwbjmyrcd-zmhdxicwsa-j |
− | + | * molecular-weight: | |
− | + | ** 847.62 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]] | |
− | = | + | * [[IVCDH]] |
− | + | * [[RXN-14264]] | |
− | * | + | * [[RXN0-2301]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-14264]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | ** | + | {{#set: common-name=isovaleryl-coa}} |
− | == | + | {{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}} |
− | * [[ | + | {{#set: molecular-weight=847.62}} |
− | * | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite ISOVALERYL-COA
- common-name:
- isovaleryl-coa
- smiles:
- cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- uyvziwwbjmyrcd-zmhdxicwsa-j
- molecular-weight:
- 847.62