Difference between revisions of "ISOVALERYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17329 == * transcription-direction: ** positive * right-end-position: ** 130562 * left-end-position: ** 116944 * centisome-position: ** 44.28087...")
 
(Created page with "Category:metabolite == Metabolite ISOVALERYL-COA == * common-name: ** isovaleryl-coa * smiles: ** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17329 ==
+
== Metabolite ISOVALERYL-COA ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** isovaleryl-coa
−
* right-end-position:
+
* smiles:
−
** 130562
+
** cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
−
* left-end-position:
+
* inchi-key:
−
** 116944
+
** uyvziwwbjmyrcd-zmhdxicwsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 44.28087   
+
** 847.62
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ISOVALERYLCOA-DHLIPOAMIDE-RXN]]
−
== Reaction(s) associated ==
+
* [[IVCDH]]
−
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[RXN-14264]]
−
** Category: [[annotation]]
+
* [[RXN0-2301]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[GTP-CYCLOHYDRO-II-RXN]]
+
* [[RXN-14264]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=isovaleryl-coa}}
−
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=uyvziwwbjmyrcd-zmhdxicwsa-j}}
−
* [[RIBOSYN2-PWY]]
+
{{#set: molecular-weight=847.62}}
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6167]]
 
−
** '''5''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6168]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7539]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=130562}}
 
−
{{#set: left-end-position=116944}}
 
−
{{#set: centisome-position=44.28087    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite ISOVALERYL-COA

  • common-name:
    • isovaleryl-coa
  • smiles:
    • cc(cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • uyvziwwbjmyrcd-zmhdxicwsa-j
  • molecular-weight:
    • 847.62

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ISOVALERYL-COA&oldid=138033"