Difference between revisions of "MANNOSE-1P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21114 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * UDPNACETYLMURAMATEDEHYDR...") |
(Created page with "Category:metabolite == Metabolite MANNOSE-1P == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** hxxf...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite MANNOSE-1P == |
| − | = | + | * common-name: |
| − | * | + | ** α-d-mannose 1-phosphate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) |
| − | * | + | * inchi-key: |
| − | * | + | ** hxxfsfrbohsimq-rwopyejcsa-l |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 258.121 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * [[ | + | * [[MANNPGUANYLTRANGDP-RXN]] |
| − | + | * [[PHOSMANMUT-RXN]] | |
| − | * [[ | + | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] |
| − | + | * [[RXN4FS-12]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[MANNPGUANYLTRANGDP-RXN]] | |
| − | {{#set: | + | * [[PHOSMANMUT-RXN]] |
| − | {{#set: | + | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| + | {{#set: common-name=α-d-mannose 1-phosphate}} | ||
| + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}} | ||
| + | {{#set: molecular-weight=258.121}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite MANNOSE-1P
- common-name:
- α-d-mannose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-rwopyejcsa-l
- molecular-weight:
- 258.121
