Difference between revisions of "CPD-474"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11771 == * transcription-direction: ** negative * right-end-position: ** 13859 * left-end-position: ** 12996 * centisome-position: ** 67.19752...")
 
(Created page with "Category:metabolite == Metabolite CPD-474 == * common-name: ** (+)-taxifolin * smiles: ** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3))) * inchi-key: ** cxqwrc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ11771 ==
+
== Metabolite CPD-474 ==
* transcription-direction:
+
* common-name:
** negative
+
** (+)-taxifolin
* right-end-position:
+
* smiles:
** 13859
+
** c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
* left-end-position:
+
* inchi-key:
** 12996
+
** cxqwrcvtcmqvqx-lsdhhaiusa-m
* centisome-position:
+
* molecular-weight:
** 67.19752   
+
** 303.248
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-527]]
== Reaction(s) associated ==
+
* [[RXN-600]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-7775]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
{{#set: transcription-direction=negative}}
+
{{#set: common-name=(+)-taxifolin}}
{{#set: right-end-position=13859}}
+
{{#set: inchi-key=inchikey=cxqwrcvtcmqvqx-lsdhhaiusa-m}}
{{#set: left-end-position=12996}}
+
{{#set: molecular-weight=303.248}}
{{#set: centisome-position=67.19752    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-474

  • common-name:
    • (+)-taxifolin
  • smiles:
    • c1(c=c(o)c(o)=cc=1c2(oc3(c=c([o-])c=c(o)c(c(=o)c(o)2)=3)))
  • inchi-key:
    • cxqwrcvtcmqvqx-lsdhhaiusa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality