Difference between revisions of "CPD-18309"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03941 == * transcription-direction: ** negative * right-end-position: ** 67298 * left-end-position: ** 63018 * centisome-position: ** 55.09578...") |
(Created page with "Category:metabolite == Metabolite CPD-18309 == * common-name: ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine * smiles: ** cc(c)c(c([o-])=o)nc(=o)c([n+])cn...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-18309 == |
− | * | + | * common-name: |
− | ** | + | ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine |
− | * | + | * smiles: |
− | ** | + | ** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1) |
− | * | + | * inchi-key: |
− | ** | + | ** hcgfosjnuodeoh-rulnzfcnsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 316.313 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-16991]] |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}} | |
− | + | {{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}} | |
− | {{#set: | + | {{#set: molecular-weight=316.313}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-18309
- common-name:
- n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine
- smiles:
- cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- hcgfosjnuodeoh-rulnzfcnsa-n
- molecular-weight:
- 316.313