Difference between revisions of "PWY66-392"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] ==
+== Pathway PWY66-392 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
+** lipoxin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
+* [[RXN-13395]]
-* inchi-key:
+== Reaction(s) not found ==
-** lioknoijmjkvcg-rdsvhmiisa-n
+* [NoneARACHIDONATE-15-LIPOXYGENASE-RXN ARACHIDONATE-15-LIPOXYGENASE-RXN]
-* molecular-weight:
+* [NoneRXN66-491 RXN66-491]
-** 821.32
+* [NoneRXN66-493 RXN66-493]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8647 RXN-8647]
-* [[RXN-9235]]
+* [NoneRXN-20577 RXN-20577]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN66-486 RXN66-486]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-20578 RXN-20578]
-{{#set: common-name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}}
+* [NoneRXN66-492 RXN66-492]
-{{#set: inchi-key=inchikey=lioknoijmjkvcg-rdsvhmiisa-n}}
+* [NoneARACHIDONATE-5-LIPOXYGENASE-RXN ARACHIDONATE-5-LIPOXYGENASE-RXN]
-{{#set: molecular-weight=821.32}}
+* [NoneRXN66-490 RXN66-490]
+* [NoneRXN-20579 RXN-20579]
+{{#set: taxonomic-range=tax-40674}}
+{{#set: common-name=lipoxin biosynthesis}}
+{{#set: nb reaction found=1}}
+{{#set: completion rate=0.09}}
+{{#set: nb total reaction=11}}