Difference between revisions of "CPD-15836"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09956 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15836 == |
| − | == | + | * common-name: |
| − | * | + | ** α-tocotrienol |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c |
| − | + | * inchi-key: | |
| − | + | ** rzfhlolgzpdchj-xzxlulotsa-n | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 424.665 |
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14918]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=α-tocotrienol}} | ||
| + | {{#set: inchi-key=inchikey=rzfhlolgzpdchj-xzxlulotsa-n}} | ||
| + | {{#set: molecular-weight=424.665}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-15836
- common-name:
- α-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
- inchi-key:
- rzfhlolgzpdchj-xzxlulotsa-n
- molecular-weight:
- 424.665
