Difference between revisions of "CPD-18493"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19012 == * transcription-direction: ** positive * right-end-position: ** 230108 * left-end-position: ** 216541 * centisome-position: ** 93.06786...")
 
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(scc...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19012 ==
+
== Metabolite CPD-18493 ==
* transcription-direction:
+
* common-name:
** positive
+
** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
* right-end-position:
+
* smiles:
** 230108
+
** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 216541
+
** nneppynerzejee-vugypbmhsa-j
* centisome-position:
+
* molecular-weight:
** 93.06786   
+
** 1120.05
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-17114]]
* [[3.3.2.10-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}
* [[RXN-17589]]
+
{{#set: molecular-weight=1120.05}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17617]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-17622]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN1A0-6303]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7778]]
 
** '''3''' reactions found over '''8''' reactions in the full pathway
 
* [[PWY1A0-6325]]
 
** '''1''' reactions found over '''12''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=230108}}
 
{{#set: left-end-position=216541}}
 
{{#set: centisome-position=93.06786    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=5}}
 
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-18493

  • common-name:
    • (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nneppynerzejee-vugypbmhsa-j
  • molecular-weight:
    • 1120.05

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality