Difference between revisions of "CPD-17401"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12901 == * transcription-direction: ** positive * right-end-position: ** 101613 * left-end-position: ** 81862 * centisome-position: ** 23.391415...")
 
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12901 ==
+
== Metabolite CPD-17401 ==
* transcription-direction:
+
* common-name:
** positive
+
** 3-oxo-auricoloyl-coa
* right-end-position:
+
* smiles:
** 101613
+
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 81862
+
** fgcwebktqlbclr-jrszcninsa-j
* centisome-position:
+
* molecular-weight:
** 23.391415   
+
** 1083.973
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16154]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-16153]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxo-auricoloyl-coa}}
* [[RXN-8443]]
+
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=1083.973}}
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5381]]
 
** '''6''' reactions found over '''11''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=101613}}
 
{{#set: left-end-position=81862}}
 
{{#set: centisome-position=23.391415    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-17401

  • common-name:
    • 3-oxo-auricoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fgcwebktqlbclr-jrszcninsa-j
  • molecular-weight:
    • 1083.973

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality