Difference between revisions of "TREHALOSE-6P"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12817 RXN-12817] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/3.6...") |
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite TREHALOSE-6P == |
| − | * | + | * common-name: |
| − | ** | + | ** α,α-trehalose 6-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o |
| − | == Reaction | + | * inchi-key: |
| − | * | + | ** labspybhmpdtel-lizsdcnhsa-l |
| − | == | + | * molecular-weight: |
| − | * | + | ** 420.263 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[TREHALOSEPHOSPHA-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[TREHALOSE6PSYN-RXN]] | |
| − | + | * [[UG6PGT]] | |
| − | + | * [[UG6PGTn]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=α,α-trehalose 6-phosphate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}} |
| − | + | {{#set: molecular-weight=420.263}} | |
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite TREHALOSE-6P
- common-name:
- α,α-trehalose 6-phosphate
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
- inchi-key:
- labspybhmpdtel-lizsdcnhsa-l
- molecular-weight:
- 420.263
