Difference between revisions of "AICAR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12903 == * transcription-direction: ** positive * right-end-position: ** 116184 * left-end-position: ** 108239 * centisome-position: ** 30.928432...")
 
(Created page with "Category:metabolite == Metabolite AICAR == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12903 ==
+
== Metabolite AICAR ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
−
* right-end-position:
+
* smiles:
−
** 116184
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
−
* left-end-position:
+
* inchi-key:
−
** 108239
+
** notgfiuvdgnkri-uuokfmhzsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 30.928432   
+
** 336.197
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[AIAL]]
−
== Reaction(s) associated ==
+
* [[AICARSYN-RXN]]
−
* [[6.1.1.24-RXN]]
+
* [[AICARTRANSFORM-RXN]]
−
** Category: [[orthology]]
+
* [[FPAIF]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* [[GLURS-RXN]]
+
* [[AIAL]]
−
** Category: [[annotation]]
+
* [[AICARSYN-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AICARTRANSFORM-RXN]]
−
* [[RXN-9386]]
+
* [[FPAIF]]
−
** Category: [[orthology]]
+
* [[GLUTAMIDOTRANS-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-14270]]
−
== Pathway(s) associated ==
+
* [[RXN-17900]]
−
* [[PWY-5188]]
+
== Reaction(s) of unknown directionality ==
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
−
* [[TRNA-CHARGING-PWY]]
+
{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
−
** '''21''' reactions found over '''21''' reactions in the full pathway
+
{{#set: molecular-weight=336.197}}
−
* [[PWY-5921]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=116184}}
 
−
{{#set: left-end-position=108239}}
 
−
{{#set: centisome-position=30.928432    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite AICAR

  • common-name:
    • 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
  • inchi-key:
    • notgfiuvdgnkri-uuokfmhzsa-l
  • molecular-weight:
    • 336.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=AICAR&oldid=138539"