Difference between revisions of "GDP-L-GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == * direction: ** left-to-right * common-name: ** (2e)-5-methylhexa-2,4-dieno...") |
(Created page with "Category:metabolite == Metabolite GDP-L-GALACTOSE == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GDP-L-GALACTOSE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** gdp-β-l-galactose |
− | * | + | * smiles: |
− | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o |
− | == | + | * inchi-key: |
− | + | ** mvmscbbuihutgj-jgqubwhwsa-l | |
− | + | * molecular-weight: | |
− | * | + | ** 603.329 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-1882]] |
− | == | + | * [[RXN4FS-12]] |
− | * [[ | + | * [[RXN4FS-13]] |
− | + | * [[RXNQT-4141]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-1882]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=gdp-β-l-galactose}} |
− | + | {{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}} | |
− | + | {{#set: molecular-weight=603.329}} | |
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GDP-L-GALACTOSE
- common-name:
- gdp-β-l-galactose
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
- inchi-key:
- mvmscbbuihutgj-jgqubwhwsa-l
- molecular-weight:
- 603.329