Difference between revisions of "CPD-10546"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.16-RXN 3.6.3.16-RXN] == * direction: ** left-to-right * common-name: ** arsenite-translocatin...")
 
(Created page with "Category:metabolite == Metabolite CPD-10546 == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) * inchi-key: ** kthadmdgdnyqrx-uhf...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.16-RXN 3.6.3.16-RXN] ==
+
== Metabolite CPD-10546 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** arsenite-translocating atpase
+
** methyl (indol-3-yl)acetate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.6.3.16 ec-3.6.3.16]
+
** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CPD-763]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-763]][e] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** kthadmdgdnyqrx-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00511]]
+
** 189.213
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10711]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-4621]], arsenate detoxification II (glutaredoxin): [http://metacyc.org/META/NEW-IMAGE?object=PWY-4621 PWY-4621]
+
== Reaction(s) of unknown directionality ==
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
{{#set: common-name=methyl (indol-3-yl)acetate}}
−
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=189.213}}
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11349 11349]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=arsenite-translocating atpase}}
 
−
{{#set: ec-number=ec-3.6.3.16}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-10546

  • common-name:
    • methyl (indol-3-yl)acetate
  • smiles:
    • coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
  • inchi-key:
    • kthadmdgdnyqrx-uhfffaoysa-n
  • molecular-weight:
    • 189.213

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10546&oldid=138551"