Difference between revisions of "DOPAMINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9205 RXN-9205] == * direction: ** left-to-right * common-name: ** s-adenosylmethionine:2-demeth...") |
(Created page with "Category:metabolite == Metabolite DOPAMINE == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inchi-key: ** vyfyytllbukuhu-uhfffaoysa-o * molecular-w...") |
||
| (9 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DOPAMINE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** dopamine |
| − | * | + | * smiles: |
| − | ** | + | ** c(cc1(c=c(c(=cc=1)o)o))[n+] |
| − | + | * inchi-key: | |
| − | + | ** vyfyytllbukuhu-uhfffaoysa-o | |
| − | == | + | * molecular-weight: |
| − | + | ** 154.188 | |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
| − | * | + | * [[RXN6666-4]] |
| − | ** | + | * [[RXN6666-9]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-221]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=dopamine}} | |
| − | + | {{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}} | |
| − | * | + | {{#set: molecular-weight=154.188}} |
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DOPAMINE
- common-name:
- dopamine
- smiles:
- c(cc1(c=c(c(=cc=1)o)o))[n+]
- inchi-key:
- vyfyytllbukuhu-uhfffaoysa-o
- molecular-weight:
- 154.188
