Difference between revisions of "CPD-193"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Apocytochromes-c == * common-name: ** an apo-[c-type cytochrome] == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYN...")
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Apocytochromes-c ==
+
== Metabolite CPD-193 ==
 
* common-name:
 
* common-name:
** an apo-[c-type cytochrome]
+
** d-myo-inositol (4,5)-bisphosphate
 +
* smiles:
 +
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
 +
* inchi-key:
 +
** mckajxmrulsuki-uzaagftcsa-j
 +
* molecular-weight:
 +
** 336.085
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
+
* [[RXN-10948]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
+
* [[RXN-10948]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an apo-[c-type cytochrome]}}
+
{{#set: common-name=d-myo-inositol (4,5)-bisphosphate}}
 +
{{#set: inchi-key=inchikey=mckajxmrulsuki-uzaagftcsa-j}}
 +
{{#set: molecular-weight=336.085}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-193

  • common-name:
    • d-myo-inositol (4,5)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
  • inchi-key:
    • mckajxmrulsuki-uzaagftcsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality