Difference between revisions of "CPD-193"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Apocytochromes-c == * common-name: ** an apo-[c-type cytochrome] == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYN...") |
(Created page with "Category:metabolite == Metabolite CPD-193 == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) *...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-193 == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol (4,5)-bisphosphate |
+ | * smiles: | ||
+ | ** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1) | ||
+ | * inchi-key: | ||
+ | ** mckajxmrulsuki-uzaagftcsa-j | ||
+ | * molecular-weight: | ||
+ | ** 336.085 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10948]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10948]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (4,5)-bisphosphate}} |
+ | {{#set: inchi-key=inchikey=mckajxmrulsuki-uzaagftcsa-j}} | ||
+ | {{#set: molecular-weight=336.085}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-193
- common-name:
- d-myo-inositol (4,5)-bisphosphate
- smiles:
- c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
- inchi-key:
- mckajxmrulsuki-uzaagftcsa-j
- molecular-weight:
- 336.085