Difference between revisions of "MG-PROTOPORPHYRIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PREPHENATE == * common-name: ** prephenate * smiles: ** c(=o)([o-])c(=o)cc1(c(=o)[o-])(c=cc(o)c=c1) * inchi-key: ** fpwmcupfbrfmlh-xgaoum...") |
(Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN == * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)[o-])...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MG-PROTOPORPHYRIN == |
+ | * smiles: | ||
+ | ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)[o-])c(n56)=c7))))8)))) | ||
* common-name: | * common-name: | ||
− | ** | + | ** mg-protoporphyrin |
− | |||
− | |||
− | |||
− | |||
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 582.94 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-20]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=mg-protoporphyrin}} |
− | + | {{#set: molecular-weight=582.94}} | |
− | {{#set: molecular-weight= |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MG-PROTOPORPHYRIN
- smiles:
- c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)[o-])c(n56)=c7))))8))))
- common-name:
- mg-protoporphyrin
- molecular-weight:
- 582.94