Difference between revisions of "S-ubiquitinyl-UCP-E2-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17382 == * common-name: ** (3r)-hydroxy-tetracosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-UCP-E2-L-cysteine == * common-name: ** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine == Reaction(s) known t...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17382 ==
+
== Metabolite S-ubiquitinyl-UCP-E2-L-cysteine ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-tetracosapentaenoyl-coa
+
** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** drqaurckckdinz-kpyxopptsa-j
 
* molecular-weight:
 
** 1120.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16130]]
+
* [[RXN-15559]]
 +
* [[RXN-15561]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16129]]
+
* [[RXN-15556]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-tetracosapentaenoyl-coa}}
+
{{#set: common-name=an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine}}
{{#set: inchi-key=inchikey=drqaurckckdinz-kpyxopptsa-j}}
 
{{#set: molecular-weight=1120.05}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite S-ubiquitinyl-UCP-E2-L-cysteine

  • common-name:
    • an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.