Difference between revisions of "CPD-10260"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...")
(Created page with "Category:metabolite == Metabolite CPD-10260 == * common-name: ** 3-oxo-stearoyl-coa * smiles: ** cccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPATE ==
+
== Metabolite CPD-10260 ==
 
* common-name:
 
* common-name:
** sinapate
+
** 3-oxo-stearoyl-coa
 
* smiles:
 
* smiles:
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
+
** cccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** pcmortlopmlefb-onegzznksa-m
+
** lgogwhdpdvauny-lfzquhgesa-j
 
* molecular-weight:
 
* molecular-weight:
** 223.205
+
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10919]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-3422]]
+
* [[RXN-9543]]
* [[RXN-8014]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapate}}
+
{{#set: common-name=3-oxo-stearoyl-coa}}
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
+
{{#set: inchi-key=inchikey=lgogwhdpdvauny-lfzquhgesa-j}}
{{#set: molecular-weight=223.205}}
+
{{#set: molecular-weight=1043.952}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-10260

  • common-name:
    • 3-oxo-stearoyl-coa
  • smiles:
    • cccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • lgogwhdpdvauny-lfzquhgesa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality