Difference between revisions of "CPD-13174"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14746 == * common-name: ** thiobenzoate * smiles: ** c(c1(c=cc=cc=1))(s)=o * inchi-key: ** uijgntrupzpvng-uhfffaoysa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CPD-13174 == * common-name: ** salicyl-6-hydroxy-2-cyclohexene-on-oyl * smiles: ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o * inchi-ke...") |
||
| (3 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-13174 == |
* common-name: | * common-name: | ||
| − | ** | + | ** salicyl-6-hydroxy-2-cyclohexene-on-oyl |
* smiles: | * smiles: | ||
| − | ** c(c1(c=cc=cc= | + | ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wyymyyoxcoemcu-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 262.262 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12252]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wyymyyoxcoemcu-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=262.262}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13174
- common-name:
- salicyl-6-hydroxy-2-cyclohexene-on-oyl
- smiles:
- c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o
- inchi-key:
- wyymyyoxcoemcu-uhfffaoysa-n
- molecular-weight:
- 262.262
