Difference between revisions of "CONIFERYL-ALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-CANALINE == * common-name: ** l-canaline * smiles: ** c(cc([n+])c(=o)[o-])on * inchi-key: ** fqpgmqabjnqllf-vkhmyheasa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite CONIFERYL-ALDEHYDE == * common-name: ** coniferaldehyde * smiles: ** coc1(=cc(c=cc=o)=cc=c(o)1) * inchi-key: ** dkzbbwmurdfhne-nscuhmnnsa...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CONIFERYL-ALDEHYDE == |
* common-name: | * common-name: | ||
| − | ** | + | ** coniferaldehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(=cc(c=cc=o)=cc=c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dkzbbwmurdfhne-nscuhmnnsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 178.187 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-1106]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coniferaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=178.187}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CONIFERYL-ALDEHYDE
- common-name:
- coniferaldehyde
- smiles:
- coc1(=cc(c=cc=o)=cc=c(o)1)
- inchi-key:
- dkzbbwmurdfhne-nscuhmnnsa-n
- molecular-weight:
- 178.187
