Difference between revisions of "CPD-14443"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GPPS GPPS] == * direction: ** left-to-right * common-name: ** geranyl pyrophosphate synthase == Rea...") |
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) * inchi-k...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14443 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate |
− | + | * smiles: | |
− | * | + | ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) |
− | + | * inchi-key: | |
− | * | + | ** dvtpryhenfbcii-imjsidkusa-l |
− | ** | + | * molecular-weight: |
− | ** | + | ** 185.136 |
− | == | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[RXN-14014]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[DIHYDRODIPICSYN-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=(2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}} |
− | + | {{#set: inchi-key=inchikey=dvtpryhenfbcii-imjsidkusa-l}} | |
− | {{#set: | + | {{#set: molecular-weight=185.136}} |
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14443
- common-name:
- (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
- smiles:
- c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
- inchi-key:
- dvtpryhenfbcii-imjsidkusa-l
- molecular-weight:
- 185.136