Difference between revisions of "MG-PROTOPORPHYRIN-MONOMETHYL-ESTER"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P-NITROPHENOL == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) * inchi-key: ** btjiuguipkrlhp-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER == * smiles: ** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P-NITROPHENOL ==
+
== Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER ==
 +
* smiles:
 +
** c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)oc)c(n56)=c7))))8))))
 
* common-name:
 
* common-name:
** 4-nitrophenol
+
** magnesium-protoporphyrin ix 13-monomethyl ester
* smiles:
 
** c1(c=c([o-])c=cc=1[n+](=o)[o-])
 
* inchi-key:
 
** btjiuguipkrlhp-uhfffaoysa-m
 
 
* molecular-weight:
 
* molecular-weight:
** 138.102
+
** 597.975
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
* [[ARYLDIALKYL-PHOSPHATASE-RXN]]
 
* [[RXN-17830]]
 
* [[RXN-8743]]
 
* [[RXN-8746]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-nitrophenol}}
+
{{#set: common-name=magnesium-protoporphyrin ix 13-monomethyl ester}}
{{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}}
+
{{#set: molecular-weight=597.975}}
{{#set: molecular-weight=138.102}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER

  • smiles:
    • c=cc2(c(c)=c4(c=c8(c(c)=c(ccc(=o)[o-])c7(=n([mg]35(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c6(c(c)=c(ccc(=o)oc)c(n56)=c7))))8))))
  • common-name:
    • magnesium-protoporphyrin ix 13-monomethyl ester
  • molecular-weight:
    • 597.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality