Difference between revisions of "SARCOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17371 == * common-name: ** 18-hydroxylinoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite SARCOSINE == * common-name: ** sarcosine * smiles: ** c[n+]cc(=o)[o-] * inchi-key: ** fsykklyzxjsnpz-uhfffaoysa-n * molecular-weight: **...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17371 ==
+
== Metabolite SARCOSINE ==
 
* common-name:
 
* common-name:
** 18-hydroxylinoleoyl-coa
+
** sarcosine
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccc=cccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c[n+]cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hjegylshikpenr-daxvlclxsa-j
+
** fsykklyzxjsnpz-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 89.094
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16118]]
+
* [[RXN-13405]]
 +
* [[RXN-8673]]
 +
* [[RXN-9679]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[CREATINASE-RXN]]
 +
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxylinoleoyl-coa}}
+
{{#set: common-name=sarcosine}}
{{#set: inchi-key=inchikey=hjegylshikpenr-daxvlclxsa-j}}
+
{{#set: inchi-key=inchikey=fsykklyzxjsnpz-uhfffaoysa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=89.094}}

Latest revision as of 11:12, 18 March 2021

Metabolite SARCOSINE

  • common-name:
    • sarcosine
  • smiles:
    • c[n+]cc(=o)[o-]
  • inchi-key:
    • fsykklyzxjsnpz-uhfffaoysa-n
  • molecular-weight:
    • 89.094

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality