Difference between revisions of "CPD-19157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2232 == * common-name: ** (s)-3-hydroxyhexadecanoyl-coa * smiles: ** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op...")
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2232 ==
+
== Metabolite CPD-19157 ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxyhexadecanoyl-coa
+
** 3-oxo-(7z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
+
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** dehlmtddpwdrdr-qqojfmbssa-j
+
** bepllrgjvxaeji-twafkmgksa-j
 
* molecular-weight:
 
* molecular-weight:
** 1017.914
+
** 985.829
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH7h]]
+
* [[RXN-17795]]
* [[HACD7h]]
 
* [[RXN-14271]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECOAH7h]]
+
* [[RXN-17794]]
* [[HACD7h]]
 
* [[RXN-14271]]
 
* [[RXN-14272]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxyhexadecanoyl-coa}}
+
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=dehlmtddpwdrdr-qqojfmbssa-j}}
+
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
{{#set: molecular-weight=1017.914}}
+
{{#set: molecular-weight=985.829}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-19157

  • common-name:
    • 3-oxo-(7z)-tetradecenoyl-coa
  • smiles:
    • ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • bepllrgjvxaeji-twafkmgksa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality