Difference between revisions of "CPD0-1162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cysteine-Desulfurase-L-cysteine == * common-name: ** an [l-cysteine desulfurase]-l-cysteine == Reaction(s) known to consume the compound...")
(Created page with "Category:metabolite == Metabolite CPD0-1162 == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cysteine-Desulfurase-L-cysteine ==
+
== Metabolite CPD0-1162 ==
 
* common-name:
 
* common-name:
** an [l-cysteine desulfurase]-l-cysteine
+
** (2e,5z)-tetradecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 +
* inchi-key:
 +
** jvefyxpcqbmmaa-zmlwrgbosa-j
 +
* molecular-weight:
 +
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12587]]
+
* [[RXN0-5393]]
* [[RXN0-308]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12473]]
+
* [[RXN-14576]]
* [[RXN-12587]]
+
* [[RXN-17783]]
* [[RXN-14382]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [l-cysteine desulfurase]-l-cysteine}}
+
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
 +
{{#set: molecular-weight=969.83}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD0-1162

  • common-name:
    • (2e,5z)-tetradecenoyl-coa
  • smiles:
    • ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • jvefyxpcqbmmaa-zmlwrgbosa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality