Difference between revisions of "Dietary-retinyl-esters"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-mevalonate 5-phosphate * smiles: ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] * inchi-key: ** okzycxhttzzysk-z...") |
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Dietary-retinyl-esters == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dietary all-trans-retinyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12579]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dietary all-trans-retinyl ester}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Dietary-retinyl-esters
- common-name:
- a dietary all-trans-retinyl ester
