Difference between revisions of "CPD-18550"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-NITROSOGLUTATHIONE == * common-name: ** s-nitrosoglutathione * smiles: ** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-ke...")
(Created page with "Category:metabolite == Metabolite CPD-18550 == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-NITROSOGLUTATHIONE ==
+
== Metabolite CPD-18550 ==
 
* common-name:
 
* common-name:
** s-nitrosoglutathione
+
** quinoxaline-2-carboxyl adenylate
 
* smiles:
 
* smiles:
** c(sn=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
 
* inchi-key:
 
* inchi-key:
** hyhsbsxuhzoylx-wdskdsinsa-m
+
** vmjweicpcdrxql-scfuhwhpsa-m
 
* molecular-weight:
 
* molecular-weight:
** 335.311
+
** 502.359
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17884]]
+
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-nitrosoglutathione}}
+
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
{{#set: inchi-key=inchikey=hyhsbsxuhzoylx-wdskdsinsa-m}}
+
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
{{#set: molecular-weight=335.311}}
+
{{#set: molecular-weight=502.359}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-18550

  • common-name:
    • quinoxaline-2-carboxyl adenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
  • inchi-key:
    • vmjweicpcdrxql-scfuhwhpsa-m
  • molecular-weight:
    • 502.359

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality