Difference between revisions of "CPD1F-114"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.5-RXN 1.3.99.5-RXN] == * direction: ** left-to-right * common-name: ** a 3-oxo-δ4-ster...")
 
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c * in...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.5-RXN 1.3.99.5-RXN] ==
+
== Metabolite CPD1F-114 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** a 3-oxo-δ4-steroid 5α-reductase
+
** all-trans-lycopene
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.3.1.22 ec-1.3.1.22]
+
** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[3-Oxo-Delta-4-Steroids]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-Oxo-5-Alpha-Steroids]][c] '''+''' 1 [[NADP]][c]
+
** oaijszizwzsqbc-gyzmgtaesa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20675]]
+
** 536.882
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN1F-150]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-8042]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=all-trans-lycopene}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R02643 R02643]
+
{{#set: molecular-weight=536.882}}
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P18405 P18405]
 
−
** [http://www.uniprot.org/uniprot/Q59327 Q59327]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=a 3-oxo-δ4-steroid 5α-reductase}}
 
−
{{#set: ec-number=ec-1.3.1.22}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD1F-114

  • common-name:
    • all-trans-lycopene
  • smiles:
    • cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
  • inchi-key:
    • oaijszizwzsqbc-gyzmgtaesa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-114&oldid=138749"