Difference between revisions of "TRNA-pseudouridine-38-39"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8088 == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-39 == * common-name: ** a pseudouridine38/39 in trna == Reaction(s) known to consume the compound == * [[RXN-12727]...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8088 ==
+
== Metabolite tRNA-pseudouridine-38-39 ==
 
* common-name:
 
* common-name:
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
+
** a pseudouridine38/39 in trna
* smiles:
 
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** rtazwrzkfstmoy-nmsvecgzsa-n
 
* molecular-weight:
 
** 784.107
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8321]]
+
* [[RXN-12727]]
* [[RXN-8328]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8320]]
+
* [[RXN-12727]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=a pseudouridine38/39 in trna}}
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
 
{{#set: molecular-weight=784.107}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite tRNA-pseudouridine-38-39

  • common-name:
    • a pseudouridine38/39 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality