Difference between revisions of "CPD-9869"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-Oxo-5-Alpha-Steroids == * common-name: ** a 3-oxo-5-α-steroid == Reaction(s) known to consume the compound == * RXN-13682 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-9869 == * common-name: ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-9869 == |
* common-name: | * common-name: | ||
− | ** | + | ** all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol |
+ | * smiles: | ||
+ | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c | ||
+ | * inchi-key: | ||
+ | ** lioknoijmjkvcg-rdsvhmiisa-n | ||
+ | * molecular-weight: | ||
+ | ** 821.32 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9235]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol}} |
+ | {{#set: inchi-key=inchikey=lioknoijmjkvcg-rdsvhmiisa-n}} | ||
+ | {{#set: molecular-weight=821.32}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9869
- common-name:
- all trans-decaprenyl-2-methoxy-6-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- lioknoijmjkvcg-rdsvhmiisa-n
- molecular-weight:
- 821.32