Difference between revisions of "CPD-15836"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Nucleotides == * common-name: ** a nucleotide == Reaction(s) known to consume the compound == * NUCLEOTIDASE-RXN == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Nucleotides ==
+
== Metabolite CPD-15836 ==
 
* common-name:
 
* common-name:
** a nucleotide
+
** α-tocotrienol
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
 +
* inchi-key:
 +
** rzfhlolgzpdchj-xzxlulotsa-n
 +
* molecular-weight:
 +
** 424.665
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NUCLEOTIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14918]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a nucleotide}}
+
{{#set: common-name=α-tocotrienol}}
 +
{{#set: inchi-key=inchikey=rzfhlolgzpdchj-xzxlulotsa-n}}
 +
{{#set: molecular-weight=424.665}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-15836

  • common-name:
    • α-tocotrienol
  • smiles:
    • cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
  • inchi-key:
    • rzfhlolgzpdchj-xzxlulotsa-n
  • molecular-weight:
    • 424.665

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality