Difference between revisions of "2-O-Methylguanosine18"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...") |
(Created page with "Category:metabolite == Metabolite 2-O-Methylguanosine18 == * common-name: ** a 2'-o-methylguanosine18 in trna == Reaction(s) known to consume the compound == == Reaction(s...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-O-Methylguanosine18 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 2'-o-methylguanosine18 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.1.1.34-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 2'-o-methylguanosine18 in trna}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite 2-O-Methylguanosine18
- common-name:
- a 2'-o-methylguanosine18 in trna