Difference between revisions of "CPD-17262"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-166 == * common-name: ** a dolichyl β-d-glucosyl phosphate == Reaction(s) known to consume the compound == * RXN-5470 * RX...")
(Created page with "Category:metabolite == Metabolite CPD-17262 == * common-name: ** 3-oxo-icosatetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-166 ==
+
== Metabolite CPD-17262 ==
 
* common-name:
 
* common-name:
** a dolichyl β-d-glucosyl phosphate
+
** 3-oxo-icosatetraenoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** vvlbcjhqulsxjn-qwoxclfssa-j
 +
* molecular-weight:
 +
** 1063.942
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5470]]
+
* [[RXN-16020]]
* [[RXN-5471]]
 
* [[RXN-5472]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.1.117-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dolichyl β-d-glucosyl phosphate}}
+
{{#set: common-name=3-oxo-icosatetraenoyl-coa}}
 +
{{#set: inchi-key=inchikey=vvlbcjhqulsxjn-qwoxclfssa-j}}
 +
{{#set: molecular-weight=1063.942}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-17262

  • common-name:
    • 3-oxo-icosatetraenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vvlbcjhqulsxjn-qwoxclfssa-j
  • molecular-weight:
    • 1063.942

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality