Difference between revisions of "CPD-14133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDRONEOPTERIN-P3 == * common-name: ** 7,8-dihydroneopterin 3'-triphosphate * smiles: ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite CPD-14133 == * common-name: ** (r)-nadphx * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDRONEOPTERIN-P3 ==
+
== Metabolite CPD-14133 ==
 
* common-name:
 
* common-name:
** 7,8-dihydroneopterin 3'-triphosphate
+
** (r)-nadphx
 
* smiles:
 
* smiles:
** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)cop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=2))
+
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
 
* inchi-key:
 
* inchi-key:
** dgguvlxvlhaagt-xinawcovsa-j
+
** szkxtjuokargiy-mtkbybfrsa-j
 
* molecular-weight:
 
* molecular-weight:
** 491.141
+
** 759.41
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.2.3.12-RXN]]
+
* [[RXN-13142]]
* [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GTP-CYCLOHYDRO-I-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydroneopterin 3'-triphosphate}}
+
{{#set: common-name=(r)-nadphx}}
{{#set: inchi-key=inchikey=dgguvlxvlhaagt-xinawcovsa-j}}
+
{{#set: inchi-key=inchikey=szkxtjuokargiy-mtkbybfrsa-j}}
{{#set: molecular-weight=491.141}}
+
{{#set: molecular-weight=759.41}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14133

  • common-name:
    • (r)-nadphx
  • smiles:
    • c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c(o)ccc(c(=o)n)=5)
  • inchi-key:
    • szkxtjuokargiy-mtkbybfrsa-j
  • molecular-weight:
    • 759.41

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality